C17H17ClFN3O3S — CID 155256274
5-(2-chloro-3-fluorophenyl)-N-(3-methoxypropyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256274) has the molecular formula C17H17ClFN3O3S and a molecular weight of 397.86 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-(3-methoxypropyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-(3-methoxypropyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256274 |
| Molecular Formula | C17H17ClFN3O3S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-(3-methoxypropyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | COCCC/N=C1/Nc2c(-c3cccc(F)c3Cl)cccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C17H17ClFN3O3S/c1-25-10-4-9-20-17-21-16-12(11-5-2-7-13(19)15(11)18)6-3-8-14(16)26(23,24)22-17/h2-3,5-8H,4,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | JDXDMLKHGIAGHW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|