C18H17ClFN3O3S — CID 155256278
5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(oxolan-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256278) has the molecular formula C18H17ClFN3O3S and a molecular weight of 409.87 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(oxolan-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(oxolan-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256278 |
| Molecular Formula | C18H17ClFN3O3S |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(oxolan-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\CC2CCCO2)Nc2c(-c3cccc(F)c3Cl)cccc21 |
| InChI | InChI=1S/C18H17ClFN3O3S/c19-16-12(5-1-7-14(16)20)13-6-2-8-15-17(13)22-18(23-27(15,24)25)21-10-11-4-3-9-26-11/h1-2,5-8,11H,3-4,9-10H2,(H2,21,22,23) |
| InChIKey | CMPMXVVXOZUTRN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|