C14H11ClFN3O2S — CID 155256290
5-(2-chlorophenyl)-7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256290) has the molecular formula C14H11ClFN3O2S and a molecular weight of 339.78 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chlorophenyl)-7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256290 |
| Molecular Formula | C14H11ClFN3O2S |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 5-(2-chlorophenyl)-7-fluoro-N-methyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | C/N=C1/Nc2c(-c3ccccc3Cl)cc(F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C14H11ClFN3O2S/c1-17-14-18-13-10(9-4-2-3-5-11(9)15)6-8(16)7-12(13)22(20,21)19-14/h2-7H,1H3,(H2,17,18,19) |
| InChIKey | RUXYEFWLZNZOIS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|