C19H13ClF2N4O2S — CID 155256305
5-(2-chlorophenyl)-7-fluoro-N-[(3-fluoro-2-pyridinyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256305) has the molecular formula C19H13ClF2N4O2S and a molecular weight of 434.86 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-fluoro-N-[(3-fluoro-2-pyridinyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chlorophenyl)-7-fluoro-N-[(3-fluoro-2-pyridinyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256305 |
| Molecular Formula | C19H13ClF2N4O2S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 5-(2-chlorophenyl)-7-fluoro-N-[(3-fluoro-2-pyridinyl)methyl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\Cc2ncccc2F)Nc2c(-c3ccccc3Cl)cc(F)cc21 |
| InChI | InChI=1S/C19H13ClF2N4O2S/c20-14-5-2-1-4-12(14)13-8-11(21)9-17-18(13)25-19(26-29(17,27)28)24-10-16-15(22)6-3-7-23-16/h1-9H,10H2,(H2,24,25,26) |
| InChIKey | XTNAHJLZTBDLFR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|