C16H15ClFN3O3S — CID 155256310
5-(2-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256310) has the molecular formula C16H15ClFN3O3S and a molecular weight of 383.83 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256310 |
| Molecular Formula | C16H15ClFN3O3S |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | COCC/N=C1/Nc2c(-c3cccc(F)c3Cl)cccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C16H15ClFN3O3S/c1-24-9-8-19-16-20-15-11(10-4-2-6-12(18)14(10)17)5-3-7-13(15)25(22,23)21-16/h2-7H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | LXIQEESQYVLNMS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|