C17H12ClFN4O3S — CID 155256331
5-(2-chloro-3-fluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256331) has the molecular formula C17H12ClFN4O3S and a molecular weight of 406.83 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256331 |
| Molecular Formula | C17H12ClFN4O3S |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-(1,3-oxazol-2-ylmethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\Cc2ncco2)Nc2c(-c3cccc(F)c3Cl)cccc21 |
| InChI | InChI=1S/C17H12ClFN4O3S/c18-15-10(3-1-5-12(15)19)11-4-2-6-13-16(11)22-17(23-27(13,24)25)21-9-14-20-7-8-26-14/h1-8H,9H2,(H2,21,22,23) |
| InChIKey | XOXPSDBEFKWMNG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|