C18H17FN4O3S — CID 155256334
2-fluoro-6-[3-(2-methoxypropylimino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-yl]benzonitrile (PubChem CID 155256334) has the molecular formula C18H17FN4O3S and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-fluoro-6-[3-(2-methoxypropylimino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-yl]benzonitrile.
| Compound Name | 2-fluoro-6-[3-(2-methoxypropylimino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 155256334 |
| Molecular Formula | C18H17FN4O3S |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-fluoro-6-[3-(2-methoxypropylimino)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-5-yl]benzonitrile |
| SMILES | COC(C)C/N=C1/Nc2c(-c3cccc(F)c3C#N)cccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C18H17FN4O3S/c1-11(26-2)10-21-18-22-17-13(6-4-8-16(17)27(24,25)23-18)12-5-3-7-15(19)14(12)9-20/h3-8,11H,10H2,1-2H3,(H2,21,22,23) |
| InChIKey | UAEMMFBNEFJHFU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|