C17H14ClF2N3O2S — CID 155256342
5-(2-chloro-3-fluorophenyl)-N-(cyclopropylmethyl)-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256342) has the molecular formula C17H14ClF2N3O2S and a molecular weight of 397.83 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-(cyclopropylmethyl)-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-(cyclopropylmethyl)-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256342 |
| Molecular Formula | C17H14ClF2N3O2S |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-(cyclopropylmethyl)-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\CC2CC2)Nc2c(-c3cccc(F)c3Cl)cc(F)cc21 |
| InChI | InChI=1S/C17H14ClF2N3O2S/c18-15-11(2-1-3-13(15)20)12-6-10(19)7-14-16(12)22-17(23-26(14,24)25)21-8-9-4-5-9/h1-3,6-7,9H,4-5,8H2,(H2,21,22,23) |
| InChIKey | IDBDAWNKZJLQQI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|