C15H12ClF2N3O2S — CID 155256463
5-(2-chloro-3-fluorophenyl)-N-ethyl-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256463) has the molecular formula C15H12ClF2N3O2S and a molecular weight of 371.80 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-ethyl-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-ethyl-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256463 |
| Molecular Formula | C15H12ClF2N3O2S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-ethyl-7-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC/N=C1/Nc2c(-c3cccc(F)c3Cl)cc(F)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C15H12ClF2N3O2S/c1-2-19-15-20-14-10(9-4-3-5-11(18)13(9)16)6-8(17)7-12(14)24(22,23)21-15/h3-7H,2H2,1H3,(H2,19,20,21) |
| InChIKey | YGMWRYYXVNXUEI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|