C18H13ClFN5O2S — CID 155256511
5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(pyrimidin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256511) has the molecular formula C18H13ClFN5O2S and a molecular weight of 417.85 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(pyrimidin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(pyrimidin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256511 |
| Molecular Formula | C18H13ClFN5O2S |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-1,1-dioxo-N-(pyrimidin-2-ylmethyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\Cc2ncccn2)Nc2c(-c3cccc(F)c3Cl)cccc21 |
| InChI | InChI=1S/C18H13ClFN5O2S/c19-16-11(4-1-6-13(16)20)12-5-2-7-14-17(12)24-18(25-28(14,26)27)23-10-15-21-8-3-9-22-15/h1-9H,10H2,(H2,23,24,25) |
| InChIKey | LRVNKLURWUFNKJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|