C15H13ClFN3O2S — CID 155256526
5-(2-chloro-3-fluorophenyl)-N-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256526) has the molecular formula C15H13ClFN3O2S and a molecular weight of 353.81 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256526 |
| Molecular Formula | C15H13ClFN3O2S |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-ethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC/N=C1/Nc2c(-c3cccc(F)c3Cl)cccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C15H13ClFN3O2S/c1-2-18-15-19-14-10(9-5-3-7-11(17)13(9)16)6-4-8-12(14)23(21,22)20-15/h3-8H,2H2,1H3,(H2,18,19,20) |
| InChIKey | ZZZLOSXYALFMSU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|