C15H11ClF3N3O2S — CID 155256528
5-(2-chloro-3-fluorophenyl)-N-(2,2-difluoroethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 155256528) has the molecular formula C15H11ClF3N3O2S and a molecular weight of 389.79 g/mol. Its IUPAC name is 5-(2-chloro-3-fluorophenyl)-N-(2,2-difluoroethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 5-(2-chloro-3-fluorophenyl)-N-(2,2-difluoroethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 155256528 |
| Molecular Formula | C15H11ClF3N3O2S |
| Molecular Weight | 389.79 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | 5-(2-chloro-3-fluorophenyl)-N-(2,2-difluoroethyl)-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | O=S1(=O)N/C(=N\CC(F)F)Nc2c(-c3cccc(F)c3Cl)cccc21 |
| InChI | InChI=1S/C15H11ClF3N3O2S/c16-13-8(3-1-5-10(13)17)9-4-2-6-11-14(9)21-15(20-7-12(18)19)22-25(11,23)24/h1-6,12H,7H2,(H2,20,21,22) |
| InChIKey | DNRCOYNHAVWMRA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|