About [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol
[1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol (PubChem CID 155256678) has the molecular formula C23H34N4O
and a molecular weight of 382.55 g/mol. Its IUPAC name is [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol |
| PubChem CID | 155256678 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol |
| SMILES | Cc1nc(N(C)C)nc(N2CCC(CO)(CCCc3ccccc3)CC2)c1C |
| InChI | InChI=1S/C23H34N4O/c1-18-19(2)24-22(26(3)4)25-21(18)27-15-13-23(17-28,14-16-27)12-8-11-20-9-6-5-7-10-20/h5-7,9-10,28H,8,11-17H2,1-4H3 |
| InChIKey | DTBMBILVQFUHDI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol?
The IUPAC name of [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol (CID 155256678) is [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol?
The canonical SMILES for [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol is Cc1nc(N(C)C)nc(N2CCC(CO)(CCCc3ccccc3)CC2)c1C.
What is the InChIKey of [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol?
The InChIKey is DTBMBILVQFUHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N4O/c1-18-19(2)24-22(26(3)4)25-21(18)27-15-13-23(17-28,14-16-27)12-8-11-20-9-6-5-7-10-20/h5-7,9-10,28H,8,11-17H2,1-4H3.
What are the key properties of [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol?
[1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol has a molecular weight of 382.55 g/mol, XLogP of 3.76, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl]-4-(3-phenylpropyl)piperidin-4-yl]methanol is sourced from PubChem (CID 155256678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).