About (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol
(3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol (PubChem CID 155257142) has the molecular formula C6H12FNO
and a molecular weight of 133.17 g/mol. Its IUPAC name is (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol |
| PubChem CID | 155257142 |
| Molecular Formula | C6H12FNO |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol |
| SMILES | CC1[C@H](O)[C@@H](F)CN1C |
| InChI | InChI=1S/C6H12FNO/c1-4-6(9)5(7)3-8(4)2/h4-6,9H,3H2,1-2H3/t4?,5-,6-/m0/s1 |
| InChIKey | TZBFWHQBXMMTBX-VZLNHYCJSA-N |
| XLogP | 0.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol?
The IUPAC name of (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol (CID 155257142) is (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol.
What is the SMILES notation for (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol?
The canonical SMILES for (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol is CC1[C@H](O)[C@@H](F)CN1C.
What is the InChIKey of (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol?
The InChIKey is TZBFWHQBXMMTBX-VZLNHYCJSA-N. The full InChI is InChI=1S/C6H12FNO/c1-4-6(9)5(7)3-8(4)2/h4-6,9H,3H2,1-2H3/t4?,5-,6-/m0/s1.
What are the key properties of (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol?
(3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol has a molecular weight of 133.17 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-fluoro-1,2-dimethylpyrrolidin-3-ol is sourced from PubChem (CID 155257142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).