C32H29N5O5S — CID 155257470
N-[1-[(E)-3-ethoxyprop-2-enoyl]-3,4-dihydro-2H-pyridin-5-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 155257470) has the molecular formula C32H29N5O5S and a molecular weight of 595.68 g/mol. Its IUPAC name is N-[1-[(E)-3-ethoxyprop-2-enoyl]-3,4-dihydro-2H-pyridin-5-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[1-[(E)-3-ethoxyprop-2-enoyl]-3,4-dihydro-2H-pyridin-5-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 155257470 |
| Molecular Formula | C32H29N5O5S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | N-[1-[(E)-3-ethoxyprop-2-enoyl]-3,4-dihydro-2H-pyridin-5-yl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CCO/C=C/C(=O)N1C=C(NC(=O)c2sc3nccc4c3c2NC(=O)N4c2ccc(Oc3ccccc3)cc2C)CCC1 |
| InChI | InChI=1S/C32H29N5O5S/c1-3-41-17-14-26(38)36-16-7-8-21(19-36)34-30(39)29-28-27-25(13-15-33-31(27)43-29)37(32(40)35-28)24-12-11-23(18-20(24)2)42-22-9-5-4-6-10-22/h4-6,9-15,17-19H,3,7-8,16H2,1-2H3,(H,34,39)(H,35,40)/b17-14+ |
| InChIKey | QDCQWUVSHHFNBK-SAPNQHFASA-N |
| XLogP | 6.82 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|