About 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine
1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine (PubChem CID 155258247) has the molecular formula C11H27N5
and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine.
Molecular Properties
| Compound Name | 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine |
| PubChem CID | 155258247 |
| Molecular Formula | C11H27N5 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.23 |
| IUPAC Name | 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine |
| SMILES | CCN(CC)C1CN(CN)CN(CNC)C1 |
| InChI | InChI=1S/C11H27N5/c1-4-16(5-2)11-6-14(8-12)10-15(7-11)9-13-3/h11,13H,4-10,12H2,1-3H3 |
| InChIKey | DDHGDVMMIHKELU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine?
The IUPAC name of 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine (CID 155258247) is 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine.
What is the SMILES notation for 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine?
The canonical SMILES for 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine is CCN(CC)C1CN(CN)CN(CNC)C1.
What is the InChIKey of 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine?
The InChIKey is DDHGDVMMIHKELU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N5/c1-4-16(5-2)11-6-14(8-12)10-15(7-11)9-13-3/h11,13H,4-10,12H2,1-3H3.
What are the key properties of 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine?
1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine has a molecular weight of 229.37 g/mol, XLogP of -0.63, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aminomethyl)-N,N-diethyl-3-(methylaminomethyl)-1,3-diazinan-5-amine is sourced from PubChem (CID 155258247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).