About 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine
3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine (PubChem CID 155258772) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine.
Molecular Properties
| Compound Name | 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine |
| PubChem CID | 155258772 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine |
| SMILES | C=C(/C(=N\C)C1=CC=CCC=C1)C(C)N |
| InChI | InChI=1S/C13H18N2/c1-10(11(2)14)13(15-3)12-8-6-4-5-7-9-12/h4,6-9,11H,1,5,14H2,2-3H3/b15-13+ |
| InChIKey | PJIVTFLPMAVUCW-FYWRMAATSA-N |
| XLogP | 2.40 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine?
The IUPAC name of 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine (CID 155258772) is 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine.
What is the SMILES notation for 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine?
The canonical SMILES for 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine is C=C(/C(=N\C)C1=CC=CCC=C1)C(C)N.
What is the InChIKey of 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine?
The InChIKey is PJIVTFLPMAVUCW-FYWRMAATSA-N. The full InChI is InChI=1S/C13H18N2/c1-10(11(2)14)13(15-3)12-8-6-4-5-7-9-12/h4,6-9,11H,1,5,14H2,2-3H3/b15-13+.
What are the key properties of 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine?
3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine has a molecular weight of 202.30 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(C-cyclohepta-1,3,6-trien-1-yl-N-methylcarbonimidoyl)but-3-en-2-amine is sourced from PubChem (CID 155258772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).