C18H24O4 — CID 155259705
cyclohexyl 6-methyl-6-(2-methylprop-2-enoyloxy)cyclohexa-1,3-diene-1-carboxylate (PubChem CID 155259705) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is cyclohexyl 6-methyl-6-(2-methylprop-2-enoyloxy)cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | cyclohexyl 6-methyl-6-(2-methylprop-2-enoyloxy)cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 155259705 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | cyclohexyl 6-methyl-6-(2-methylprop-2-enoyloxy)cyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1(C)CC=CC=C1C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C18H24O4/c1-13(2)16(19)22-18(3)12-8-7-11-15(18)17(20)21-14-9-5-4-6-10-14/h7-8,11,14H,1,4-6,9-10,12H2,2-3H3 |
| InChIKey | AGPZOZIRKWRSMX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|