C30H35Cl2N7O5 — CID 155259846
1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2,3-dihydroxypropylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155259846) has the molecular formula C30H35Cl2N7O5 and a molecular weight of 644.56 g/mol. Its IUPAC name is 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2,3-dihydroxypropylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2,3-dihydroxypropylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155259846 |
| Molecular Formula | C30H35Cl2N7O5 |
| Molecular Weight | 644.56 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2,3-dihydroxypropylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NCC(O)CO)nc23)CC1 |
| InChI | InChI=1S/C30H35Cl2N7O5/c1-4-24(42)38-10-8-37(9-11-38)7-5-6-19-16-39-28-18(14-33-30(36-28)34-15-20(41)17-40)12-21(29(39)35-19)25-26(31)22(43-2)13-23(44-3)27(25)32/h4,12-14,16,20,40-41H,1,5-11,15,17H2,2-3H3,(H,33,34,36) |
| InChIKey | MJQOUGQWOUEOQW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|