C32H37Cl2N7O4 — CID 155259873
1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(oxolan-3-ylmethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155259873) has the molecular formula C32H37Cl2N7O4 and a molecular weight of 654.60 g/mol. Its IUPAC name is 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(oxolan-3-ylmethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(oxolan-3-ylmethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155259873 |
| Molecular Formula | C32H37Cl2N7O4 |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(oxolan-3-ylmethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NCC4CCOC4)nc23)CC1 |
| InChI | InChI=1S/C32H37Cl2N7O4/c1-4-26(42)40-11-9-39(10-12-40)8-5-6-22-18-41-30-21(17-36-32(38-30)35-16-20-7-13-45-19-20)14-23(31(41)37-22)27-28(33)24(43-2)15-25(44-3)29(27)34/h4,14-15,17-18,20H,1,5-13,16,19H2,2-3H3,(H,35,36,38) |
| InChIKey | DTMBBUXRPGEWHN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|