About 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine
1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine (PubChem CID 155260560) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine |
| PubChem CID | 155260560 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine |
| SMILES | C=C/C=C\CCC(CNNC)C(C)CC=C |
| InChI | InChI=1S/C14H26N2/c1-5-7-8-9-11-14(12-16-15-4)13(3)10-6-2/h5-8,13-16H,1-2,9-12H2,3-4H3/b8-7- |
| InChIKey | LKYQXBXBNTXNDN-FPLPWBNLSA-N |
| XLogP | 3.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine?
The IUPAC name of 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine (CID 155260560) is 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine.
What is the SMILES notation for 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine?
The canonical SMILES for 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine is C=C/C=C\CCC(CNNC)C(C)CC=C.
What is the InChIKey of 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine?
The InChIKey is LKYQXBXBNTXNDN-FPLPWBNLSA-N. The full InChI is InChI=1S/C14H26N2/c1-5-7-8-9-11-14(12-16-15-4)13(3)10-6-2/h5-8,13-16H,1-2,9-12H2,3-4H3/b8-7-.
What are the key properties of 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine?
1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine has a molecular weight of 222.38 g/mol, XLogP of 3.06, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(5Z)-2-pent-4-en-2-ylocta-5,7-dienyl]hydrazine is sourced from PubChem (CID 155260560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).