About pentanimidoylsulfanyl hexanimidothioate
pentanimidoylsulfanyl hexanimidothioate (PubChem CID 155260657) has the molecular formula C11H22N2S2
and a molecular weight of 246.44 g/mol. Its IUPAC name is pentanimidoylsulfanyl hexanimidothioate.
Molecular Properties
| Compound Name | pentanimidoylsulfanyl hexanimidothioate |
| PubChem CID | 155260657 |
| Molecular Formula | C11H22N2S2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | pentanimidoylsulfanyl hexanimidothioate |
| SMILES | [H]/N=C(\CCCC)SS/C(CCCCC)=N/[H] |
| InChI | InChI=1S/C11H22N2S2/c1-3-5-7-9-11(13)15-14-10(12)8-6-4-2/h12-13H,3-9H2,1-2H3/b12-10+,13-11+ |
| InChIKey | UQKDTVHFVMMMBD-DCIPZJNNSA-N |
| XLogP | 5.09 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze pentanimidoylsulfanyl hexanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentanimidoylsulfanyl hexanimidothioate?
The IUPAC name of pentanimidoylsulfanyl hexanimidothioate (CID 155260657) is pentanimidoylsulfanyl hexanimidothioate.
What is the SMILES notation for pentanimidoylsulfanyl hexanimidothioate?
The canonical SMILES for pentanimidoylsulfanyl hexanimidothioate is [H]/N=C(\CCCC)SS/C(CCCCC)=N/[H].
What is the InChIKey of pentanimidoylsulfanyl hexanimidothioate?
The InChIKey is UQKDTVHFVMMMBD-DCIPZJNNSA-N. The full InChI is InChI=1S/C11H22N2S2/c1-3-5-7-9-11(13)15-14-10(12)8-6-4-2/h12-13H,3-9H2,1-2H3/b12-10+,13-11+.
What are the key properties of pentanimidoylsulfanyl hexanimidothioate?
pentanimidoylsulfanyl hexanimidothioate has a molecular weight of 246.44 g/mol, XLogP of 5.09, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pentanimidoylsulfanyl hexanimidothioate is sourced from PubChem (CID 155260657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).