C18H25N7O5 — CID 155260750
[(4R,10R)-2,6-diamino-1,10-dihydroxy-10-methyl-9-phenylmethoxy-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate (PubChem CID 155260750) has the molecular formula C18H25N7O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is [(4R,10R)-2,6-diamino-1,10-dihydroxy-10-methyl-9-phenylmethoxy-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate.
| Compound Name | [(4R,10R)-2,6-diamino-1,10-dihydroxy-10-methyl-9-phenylmethoxy-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate |
|---|---|
| PubChem CID | 155260750 |
| Molecular Formula | C18H25N7O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [(4R,10R)-2,6-diamino-1,10-dihydroxy-10-methyl-9-phenylmethoxy-3a,4,8,9-tetrahydropyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| SMILES | C[C@]1(O)C(OCc2ccccc2)CN2C(N)=N[C@@H](COC(N)=O)C3N=C(N)N(O)C321 |
| InChI | InChI=1S/C18H25N7O5/c1-17(27)12(29-8-10-5-3-2-4-6-10)7-24-14(19)22-11(9-30-16(21)26)13-18(17,24)25(28)15(20)23-13/h2-6,11-13,27-28H,7-9H2,1H3,(H2,19,22)(H2,20,23)(H2,21,26)/t11-,12?,13?,17-,18?/m0/s1 |
| InChIKey | XTEIHEXVABSAHQ-LGNWSAGOSA-N |
| XLogP | -1.49 |
| TPSA | 185.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |