C26H24ClFN4O5 — CID 155261028
(7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(oxolan-3-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155261028) has the molecular formula C26H24ClFN4O5 and a molecular weight of 526.95 g/mol. Its IUPAC name is (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(oxolan-3-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(oxolan-3-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155261028 |
| Molecular Formula | C26H24ClFN4O5 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(oxolan-3-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=CC(=O)N1CCN2c3nc(=O)n(C4CCOC4)c4cc(-c5c(O)cccc5F)c(Cl)c(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C26H24ClFN4O5/c1-2-20(34)30-7-8-31-15(11-30)13-37-24-22-18(32(14-6-9-36-12-14)26(35)29-25(22)31)10-16(23(24)27)21-17(28)4-3-5-19(21)33/h2-5,10,14-15,33H,1,6-9,11-13H2/t14?,15-/m0/s1 |
| InChIKey | HABUNDXDFKZZAV-LOACHALJSA-N |
| XLogP | 3.12 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|