C28H29ClFN5O4 — CID 155261050
(7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(1-methylpiperidin-4-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one (PubChem CID 155261050) has the molecular formula C28H29ClFN5O4 and a molecular weight of 554.02 g/mol. Its IUPAC name is (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(1-methylpiperidin-4-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one.
| Compound Name | (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(1-methylpiperidin-4-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
|---|---|
| PubChem CID | 155261050 |
| Molecular Formula | C28H29ClFN5O4 |
| Molecular Weight | 554.02 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | (7S)-11-chloro-12-(2-fluoro-6-hydroxyphenyl)-15-(1-methylpiperidin-4-yl)-5-prop-2-enoyl-9-oxa-2,5,15,17-tetrazatetracyclo[8.7.1.02,7.014,18]octadeca-1(17),10,12,14(18)-tetraen-16-one |
| SMILES | C=CC(=O)N1CCN2c3nc(=O)n(C4CCN(C)CC4)c4cc(-c5c(O)cccc5F)c(Cl)c(c34)OC[C@@H]2C1 |
| InChI | InChI=1S/C28H29ClFN5O4/c1-3-22(37)33-11-12-34-17(14-33)15-39-26-24-20(13-18(25(26)29)23-19(30)5-4-6-21(23)36)35(28(38)31-27(24)34)16-7-9-32(2)10-8-16/h3-6,13,16-17,36H,1,7-12,14-15H2,2H3/t17-/m0/s1 |
| InChIKey | KIIJQECBGHQXMZ-KRWDZBQOSA-N |
| XLogP | 3.42 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|