C12H19F4N — CID 155261756
(1E,3E)-5-ethyl-4-fluoro-6,6-dimethyl-2-(trifluoromethyl)hepta-1,3-dien-1-amine (PubChem CID 155261756) has the molecular formula C12H19F4N and a molecular weight of 253.28 g/mol. Its IUPAC name is (1E,3E)-5-ethyl-4-fluoro-6,6-dimethyl-2-(trifluoromethyl)hepta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-5-ethyl-4-fluoro-6,6-dimethyl-2-(trifluoromethyl)hepta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155261756 |
| Molecular Formula | C12H19F4N |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1E,3E)-5-ethyl-4-fluoro-6,6-dimethyl-2-(trifluoromethyl)hepta-1,3-dien-1-amine |
| SMILES | CCC(/C(F)=C\C(=C/N)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H19F4N/c1-5-9(11(2,3)4)10(13)6-8(7-17)12(14,15)16/h6-7,9H,5,17H2,1-4H3/b8-7+,10-6+ |
| InChIKey | HLIVWWBPWQPQOM-IQXTZUCASA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|