C21H28N6S — CID 155261982
8,9-dicyclopropyl-N-(1-methylsulfanylpiperidin-4-yl)-5,6-dihydropyrazolo[3,4-h]quinazolin-2-amine (PubChem CID 155261982) has the molecular formula C21H28N6S and a molecular weight of 396.56 g/mol. Its IUPAC name is 8,9-dicyclopropyl-N-(1-methylsulfanylpiperidin-4-yl)-5,6-dihydropyrazolo[3,4-h]quinazolin-2-amine.
| Compound Name | 8,9-dicyclopropyl-N-(1-methylsulfanylpiperidin-4-yl)-5,6-dihydropyrazolo[3,4-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 155261982 |
| Molecular Formula | C21H28N6S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 8,9-dicyclopropyl-N-(1-methylsulfanylpiperidin-4-yl)-5,6-dihydropyrazolo[3,4-h]quinazolin-2-amine |
| SMILES | CSN1CCC(Nc2ncc3c(n2)-c2c(nn(C4CC4)c2C2CC2)CC3)CC1 |
| InChI | InChI=1S/C21H28N6S/c1-28-26-10-8-15(9-11-26)23-21-22-12-14-4-7-17-18(19(14)24-21)20(13-2-3-13)27(25-17)16-5-6-16/h12-13,15-16H,2-11H2,1H3,(H,22,23,24) |
| InChIKey | QZPXOZBYMGMOJK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|