About 3-methyl-2,3-dihydro-1-benzofuran-5-thiol
3-methyl-2,3-dihydro-1-benzofuran-5-thiol (PubChem CID 155261995) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is 3-methyl-2,3-dihydro-1-benzofuran-5-thiol.
Molecular Properties
| Compound Name | 3-methyl-2,3-dihydro-1-benzofuran-5-thiol |
| PubChem CID | 155261995 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3-methyl-2,3-dihydro-1-benzofuran-5-thiol |
| SMILES | CC1COc2ccc(S)cc21 |
| InChI | InChI=1S/C9H10OS/c1-6-5-10-9-3-2-7(11)4-8(6)9/h2-4,6,11H,5H2,1H3 |
| InChIKey | DBRNPGXIROPDPN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,3-dihydro-1-benzofuran-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,3-dihydro-1-benzofuran-5-thiol?
The IUPAC name of 3-methyl-2,3-dihydro-1-benzofuran-5-thiol (CID 155261995) is 3-methyl-2,3-dihydro-1-benzofuran-5-thiol.
What is the SMILES notation for 3-methyl-2,3-dihydro-1-benzofuran-5-thiol?
The canonical SMILES for 3-methyl-2,3-dihydro-1-benzofuran-5-thiol is CC1COc2ccc(S)cc21.
What is the InChIKey of 3-methyl-2,3-dihydro-1-benzofuran-5-thiol?
The InChIKey is DBRNPGXIROPDPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-6-5-10-9-3-2-7(11)4-8(6)9/h2-4,6,11H,5H2,1H3.
What are the key properties of 3-methyl-2,3-dihydro-1-benzofuran-5-thiol?
3-methyl-2,3-dihydro-1-benzofuran-5-thiol has a molecular weight of 166.25 g/mol, XLogP of 2.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,3-dihydro-1-benzofuran-5-thiol is sourced from PubChem (CID 155261995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).