C15H31N — CID 155262275
(Z)-3-ethyl-N,2,2,3-tetramethyl-N-propan-2-ylhex-4-en-1-amine (PubChem CID 155262275) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is (Z)-3-ethyl-N,2,2,3-tetramethyl-N-propan-2-ylhex-4-en-1-amine.
| Compound Name | (Z)-3-ethyl-N,2,2,3-tetramethyl-N-propan-2-ylhex-4-en-1-amine |
|---|---|
| PubChem CID | 155262275 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (Z)-3-ethyl-N,2,2,3-tetramethyl-N-propan-2-ylhex-4-en-1-amine |
| SMILES | C/C=C\C(C)(CC)C(C)(C)CN(C)C(C)C |
| InChI | InChI=1S/C15H31N/c1-9-11-15(7,10-2)14(5,6)12-16(8)13(3)4/h9,11,13H,10,12H2,1-8H3/b11-9- |
| InChIKey | RJFUNMYVLMVTII-LUAWRHEFSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|