C28H25F11O6S — CID 155262601
7-[2-[[(1,1-difluoro-2-methoxyethoxy)-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl]sulfanyl-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 155262601) has the molecular formula C28H25F11O6S and a molecular weight of 698.55 g/mol. Its IUPAC name is 7-[2-[[(1,1-difluoro-2-methoxyethoxy)-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl]sulfanyl-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 7-[2-[[(1,1-difluoro-2-methoxyethoxy)-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl]sulfanyl-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 155262601 |
| Molecular Formula | C28H25F11O6S |
| Molecular Weight | 698.55 g/mol |
| Exact Mass | 698.12 |
| IUPAC Name | 7-[2-[[(1,1-difluoro-2-methoxyethoxy)-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl]sulfanyl-3-[4-pentyl-2-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(SCC(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)COC)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F11O6S/c1-3-4-5-6-16-7-10-19(21(11-16)26(33,34)35)20-12-17-8-9-18(13-22(17)42-23(20)40)46-15-25(31,32)44-28(38,39)45-27(36,37)43-24(29,30)14-41-2/h7-13H,3-6,14-15H2,1-2H3 |
| InChIKey | XDTYIMFEUIJRIN-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.55 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|