C24H28O5 — CID 155262604
3-(4-butoxyphenyl)-7-(3-hydroxy-2,2-dimethylpropoxy)chromen-2-one (PubChem CID 155262604) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-7-(3-hydroxy-2,2-dimethylpropoxy)chromen-2-one.
| Compound Name | 3-(4-butoxyphenyl)-7-(3-hydroxy-2,2-dimethylpropoxy)chromen-2-one |
|---|---|
| PubChem CID | 155262604 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 3-(4-butoxyphenyl)-7-(3-hydroxy-2,2-dimethylpropoxy)chromen-2-one |
| SMILES | CCCCOc1ccc(-c2cc3ccc(OCC(C)(C)CO)cc3oc2=O)cc1 |
| InChI | InChI=1S/C24H28O5/c1-4-5-12-27-19-9-6-17(7-10-19)21-13-18-8-11-20(14-22(18)29-23(21)26)28-16-24(2,3)15-25/h6-11,13-14,25H,4-5,12,15-16H2,1-3H3 |
| InChIKey | XAPWITSENJHUHP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|