C23H25ClF3N3O4 — CID 155263251
(2R,4R)-6-chloro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 155263251) has the molecular formula C23H25ClF3N3O4 and a molecular weight of 499.92 g/mol. Its IUPAC name is (2R,4R)-6-chloro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-6-chloro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 155263251 |
| Molecular Formula | C23H25ClF3N3O4 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (2R,4R)-6-chloro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | C=C(CCn1cc(OC2CC(CC(F)(F)F)C2)cn1)NC(=O)[C@H]1C[C@@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C23H25ClF3N3O4/c1-13(29-22(32)21-9-19(31)18-8-15(24)2-3-20(18)34-21)4-5-30-12-17(11-28-30)33-16-6-14(7-16)10-23(25,26)27/h2-3,8,11-12,14,16,19,21,31H,1,4-7,9-10H2,(H,29,32)/t14?,16?,19-,21-/m1/s1 |
| InChIKey | HADIRJQKOVWHIS-FQKVBLJMSA-N |
| XLogP | 4.55 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |