C23H24ClF4N3O4 — CID 155263260
(2R,4R)-6-chloro-7-fluoro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide (PubChem CID 155263260) has the molecular formula C23H24ClF4N3O4 and a molecular weight of 517.91 g/mol. Its IUPAC name is (2R,4R)-6-chloro-7-fluoro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide.
| Compound Name | (2R,4R)-6-chloro-7-fluoro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
|---|---|
| PubChem CID | 155263260 |
| Molecular Formula | C23H24ClF4N3O4 |
| Molecular Weight | 517.91 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (2R,4R)-6-chloro-7-fluoro-4-hydroxy-N-[4-[4-[3-(2,2,2-trifluoroethyl)cyclobutyl]oxypyrazol-1-yl]but-1-en-2-yl]-3,4-dihydro-2H-chromene-2-carboxamide |
| SMILES | C=C(CCn1cc(OC2CC(CC(F)(F)F)C2)cn1)NC(=O)[C@H]1C[C@@H](O)c2cc(Cl)c(F)cc2O1 |
| InChI | InChI=1S/C23H24ClF4N3O4/c1-12(30-22(33)21-8-19(32)16-6-17(24)18(25)7-20(16)35-21)2-3-31-11-15(10-29-31)34-14-4-13(5-14)9-23(26,27)28/h6-7,10-11,13-14,19,21,32H,1-5,8-9H2,(H,30,33)/t13?,14?,19-,21-/m1/s1 |
| InChIKey | WLNCTCNABZODQY-LHLYLMPZSA-N |
| XLogP | 4.69 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |