C29H37N7O6 — CID 155263344
2-[2-[2-(aminodiazenyl)ethoxy]ethoxy]-N-[3-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-4-oxoquinazolin-7-yl]acetamide (PubChem CID 155263344) has the molecular formula C29H37N7O6 and a molecular weight of 579.66 g/mol. Its IUPAC name is 2-[2-[2-(aminodiazenyl)ethoxy]ethoxy]-N-[3-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-4-oxoquinazolin-7-yl]acetamide.
| Compound Name | 2-[2-[2-(aminodiazenyl)ethoxy]ethoxy]-N-[3-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-4-oxoquinazolin-7-yl]acetamide |
|---|---|
| PubChem CID | 155263344 |
| Molecular Formula | C29H37N7O6 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.28 |
| IUPAC Name | 2-[2-[2-(aminodiazenyl)ethoxy]ethoxy]-N-[3-[[4-hydroxy-1-(3-phenylpropanoyl)piperidin-4-yl]methyl]-4-oxoquinazolin-7-yl]acetamide |
| SMILES | N/N=N/CCOCCOCC(=O)Nc1ccc2c(=O)n(CC3(O)CCN(C(=O)CCc4ccccc4)CC3)cnc2c1 |
| InChI | InChI=1S/C29H37N7O6/c30-34-32-12-15-41-16-17-42-19-26(37)33-23-7-8-24-25(18-23)31-21-36(28(24)39)20-29(40)10-13-35(14-11-29)27(38)9-6-22-4-2-1-3-5-22/h1-5,7-8,18,21,40H,6,9-17,19-20H2,(H2,30,32)(H,33,37) |
| InChIKey | UGDRKBBYMQUPRR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 173.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|