C13H21NO3Si2 — CID 15526368
(2-hydroxyphenyl)-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone (PubChem CID 15526368) has the molecular formula C13H21NO3Si2 and a molecular weight of 295.49 g/mol. Its IUPAC name is (2-hydroxyphenyl)-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone.
| Compound Name | (2-hydroxyphenyl)-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone |
|---|---|
| PubChem CID | 15526368 |
| Molecular Formula | C13H21NO3Si2 |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2-hydroxyphenyl)-(2,2,6,6-tetramethyl-1,4,2,6-oxazadisilinan-4-yl)methanone |
| SMILES | C[Si]1(C)CN(C(=O)c2ccccc2O)C[Si](C)(C)O1 |
| InChI | InChI=1S/C13H21NO3Si2/c1-18(2)9-14(10-19(3,4)17-18)13(16)11-7-5-6-8-12(11)15/h5-8,15H,9-10H2,1-4H3 |
| InChIKey | DGXRFYMTQGPZDL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|