About (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol
(2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol (PubChem CID 155264175) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol.
Molecular Properties
| Compound Name | (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol |
| PubChem CID | 155264175 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol |
| SMILES | C/C=N/C(=C/C)C(=CCC)/C=C(\C)S |
| InChI | InChI=1S/C12H19NS/c1-5-8-11(9-10(4)14)12(6-2)13-7-3/h6-9,14H,5H2,1-4H3/b10-9+,11-8-,12-6+,13-7+ |
| InChIKey | NECXKJZWXZKGMI-UVUFODSJSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol?
The IUPAC name of (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol (CID 155264175) is (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol.
What is the SMILES notation for (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol?
The canonical SMILES for (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol is C/C=N/C(=C/C)C(=CCC)/C=C(\C)S.
What is the InChIKey of (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol?
The InChIKey is NECXKJZWXZKGMI-UVUFODSJSA-N. The full InChI is InChI=1S/C12H19NS/c1-5-8-11(9-10(4)14)12(6-2)13-7-3/h6-9,14H,5H2,1-4H3/b10-9+,11-8-,12-6+,13-7+.
What are the key properties of (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol?
(2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol has a molecular weight of 209.36 g/mol, XLogP of 4.15, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-[(E)-1-(ethylideneamino)prop-1-enyl]hepta-2,4-diene-2-thiol is sourced from PubChem (CID 155264175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).