C21H39N3 — CID 155264188
2-[1-(1,5-dimethylpiperidin-2-yl)-7-methyl-2-propyl-2,3,3a,4,7,7a-hexahydroindol-3-yl]ethanamine (PubChem CID 155264188) has the molecular formula C21H39N3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-[1-(1,5-dimethylpiperidin-2-yl)-7-methyl-2-propyl-2,3,3a,4,7,7a-hexahydroindol-3-yl]ethanamine.
| Compound Name | 2-[1-(1,5-dimethylpiperidin-2-yl)-7-methyl-2-propyl-2,3,3a,4,7,7a-hexahydroindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 155264188 |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.31 |
| IUPAC Name | 2-[1-(1,5-dimethylpiperidin-2-yl)-7-methyl-2-propyl-2,3,3a,4,7,7a-hexahydroindol-3-yl]ethanamine |
| SMILES | CCCC1C(CCN)C2CC=CC(C)C2N1C1CCC(C)CN1C |
| InChI | InChI=1S/C21H39N3/c1-5-7-19-17(12-13-22)18-9-6-8-16(3)21(18)24(19)20-11-10-15(2)14-23(20)4/h6,8,15-21H,5,7,9-14,22H2,1-4H3 |
| InChIKey | JNUILBMOZQHPMJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|