C27H29Cl3N4O — CID 155264294
5-[5-(4-chlorophenyl)-3-nonylimidazol-4-yl]-3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazole (PubChem CID 155264294) has the molecular formula C27H29Cl3N4O and a molecular weight of 531.92 g/mol. Its IUPAC name is 5-[5-(4-chlorophenyl)-3-nonylimidazol-4-yl]-3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-[5-(4-chlorophenyl)-3-nonylimidazol-4-yl]-3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155264294 |
| Molecular Formula | C27H29Cl3N4O |
| Molecular Weight | 531.92 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 5-[5-(4-chlorophenyl)-3-nonylimidazol-4-yl]-3-[(3,4-dichlorophenyl)methyl]-1,2,4-oxadiazole |
| SMILES | CCCCCCCCCn1cnc(-c2ccc(Cl)cc2)c1-c1nc(Cc2ccc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C27H29Cl3N4O/c1-2-3-4-5-6-7-8-15-34-18-31-25(20-10-12-21(28)13-11-20)26(34)27-32-24(33-35-27)17-19-9-14-22(29)23(30)16-19/h9-14,16,18H,2-8,15,17H2,1H3 |
| InChIKey | GUCDJVKNEHJNFA-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.92 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|