C21H24Cl2N4O9P2 — CID 155265053
[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155265053) has the molecular formula C21H24Cl2N4O9P2 and a molecular weight of 609.30 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155265053 |
| Molecular Formula | C21H24Cl2N4O9P2 |
| Molecular Weight | 609.30 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1R)-5-chloro-2,3-dihydro-1H-inden-1-yl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)OC[C@H]1O[C@@H](n2ncc3c(N[C@@H]4CCc5cc(Cl)ccc54)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24Cl2N4O9P2/c22-11-2-3-12-10(5-11)1-4-14(12)25-15-6-17(23)26-20-13(15)7-24-27(20)21-19(29)18(28)16(36-21)8-35-38(33,34)9-37(30,31)32/h2-3,5-7,14,16,18-19,21,28-29H,1,4,8-9H2,(H,25,26)(H,33,34)(H2,30,31,32)/t14-,16-,18-,19-,21-/m1/s1 |
| InChIKey | QJZUQGQBQRTMIO-PZBVGEIHSA-N |
| XLogP | 2.79 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|