C27H33F3N2O3S — CID 155265558
[3,3,3-trifluoro-2-[(2-phenyl-1-benzofuran-6-yl)sulfanylmethyl]propyl] 3,5-diamino-2,2,5-trimethylhexanoate (PubChem CID 155265558) has the molecular formula C27H33F3N2O3S and a molecular weight of 522.63 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[(2-phenyl-1-benzofuran-6-yl)sulfanylmethyl]propyl] 3,5-diamino-2,2,5-trimethylhexanoate.
| Compound Name | [3,3,3-trifluoro-2-[(2-phenyl-1-benzofuran-6-yl)sulfanylmethyl]propyl] 3,5-diamino-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 155265558 |
| Molecular Formula | C27H33F3N2O3S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | [3,3,3-trifluoro-2-[(2-phenyl-1-benzofuran-6-yl)sulfanylmethyl]propyl] 3,5-diamino-2,2,5-trimethylhexanoate |
| SMILES | CC(C)(N)CC(N)C(C)(C)C(=O)OCC(CSc1ccc2cc(-c3ccccc3)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C27H33F3N2O3S/c1-25(2,32)14-23(31)26(3,4)24(33)34-15-19(27(28,29)30)16-36-20-11-10-18-12-21(35-22(18)13-20)17-8-6-5-7-9-17/h5-13,19,23H,14-16,31-32H2,1-4H3 |
| InChIKey | ZIOXSUGQNHJWJG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |