C20H29N3 — CID 155266249
(1S)-N-[[1-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methyl]-2-phenylcyclopropan-1-amine (PubChem CID 155266249) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (1S)-N-[[1-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methyl]-2-phenylcyclopropan-1-amine.
| Compound Name | (1S)-N-[[1-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 155266249 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | (1S)-N-[[1-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)cyclopropyl]methyl]-2-phenylcyclopropan-1-amine |
| SMILES | c1ccc(C2C[C@@H]2NCC2(CN3CC4CNCC4C3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3/c1-2-4-15(5-3-1)18-8-19(18)22-13-20(6-7-20)14-23-11-16-9-21-10-17(16)12-23/h1-5,16-19,21-22H,6-14H2/t16?,17?,18?,19-/m0/s1 |
| InChIKey | DTFYPBCVVMSIMQ-LFVBFMBRSA-N |
| XLogP | 2.06 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |