About 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide
2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide (PubChem CID 155266958) has the molecular formula C9H14F3N3
and a molecular weight of 221.23 g/mol. Its IUPAC name is 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide.
Molecular Properties
| Compound Name | 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide |
| PubChem CID | 155266958 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide |
| SMILES | C/C=C\C(=C/N=C(\N)C(C)N)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N3/c1-3-4-7(9(10,11)12)5-15-8(14)6(2)13/h3-6H,13H2,1-2H3,(H2,14,15)/b4-3-,7-5+ |
| InChIKey | WVSKZCPBIQCJGZ-QVXLNCAUSA-N |
| XLogP | 1.71 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide?
The IUPAC name of 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide (CID 155266958) is 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide.
What is the SMILES notation for 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide?
The canonical SMILES for 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide is C/C=C\C(=C/N=C(\N)C(C)N)C(F)(F)F.
What is the InChIKey of 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide?
The InChIKey is WVSKZCPBIQCJGZ-QVXLNCAUSA-N. The full InChI is InChI=1S/C9H14F3N3/c1-3-4-7(9(10,11)12)5-15-8(14)6(2)13/h3-6H,13H2,1-2H3,(H2,14,15)/b4-3-,7-5+.
What are the key properties of 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide?
2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide has a molecular weight of 221.23 g/mol, XLogP of 1.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]propanimidamide is sourced from PubChem (CID 155266958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).