About 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine
3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine (PubChem CID 155266972) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine |
| PubChem CID | 155266972 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine |
| SMILES | C=CC(=C)C1CN(C)CCC1C |
| InChI | InChI=1S/C11H19N/c1-5-9(2)11-8-12(4)7-6-10(11)3/h5,10-11H,1-2,6-8H2,3-4H3 |
| InChIKey | HTCSUYDPTCSAIB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine?
The IUPAC name of 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine (CID 155266972) is 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine.
What is the SMILES notation for 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine?
The canonical SMILES for 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine is C=CC(=C)C1CN(C)CCC1C.
What is the InChIKey of 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine?
The InChIKey is HTCSUYDPTCSAIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-5-9(2)11-8-12(4)7-6-10(11)3/h5,10-11H,1-2,6-8H2,3-4H3.
What are the key properties of 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine?
3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine has a molecular weight of 165.28 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-1,3-dien-2-yl-1,4-dimethylpiperidine is sourced from PubChem (CID 155266972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).