C24H27N5O2 — CID 155267696
8-[4-(1-methylbenzimidazol-5-yl)benzoyl]-5,8,11-triazaspiro[3.8]dodecan-12-one (PubChem CID 155267696) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 8-[4-(1-methylbenzimidazol-5-yl)benzoyl]-5,8,11-triazaspiro[3.8]dodecan-12-one.
| Compound Name | 8-[4-(1-methylbenzimidazol-5-yl)benzoyl]-5,8,11-triazaspiro[3.8]dodecan-12-one |
|---|---|
| PubChem CID | 155267696 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 8-[4-(1-methylbenzimidazol-5-yl)benzoyl]-5,8,11-triazaspiro[3.8]dodecan-12-one |
| SMILES | Cn1cnc2cc(-c3ccc(C(=O)N4CCNC(=O)C5(CCC5)NCC4)cc3)ccc21 |
| InChI | InChI=1S/C24H27N5O2/c1-28-16-26-20-15-19(7-8-21(20)28)17-3-5-18(6-4-17)22(30)29-13-11-25-23(31)24(9-2-10-24)27-12-14-29/h3-8,15-16,27H,2,9-14H2,1H3,(H,25,31) |
| InChIKey | MOFGSQXIFKZKLB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |