C18H21ClFN6O8PS — CID 155268110
[(2S,3S,4R,5R)-5-[5-chloro-7-[[(1S)-1-(4-fluorophenyl)ethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 155268110) has the molecular formula C18H21ClFN6O8PS and a molecular weight of 566.89 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[5-chloro-7-[[(1S)-1-(4-fluorophenyl)ethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[5-chloro-7-[[(1S)-1-(4-fluorophenyl)ethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 155268110 |
| Molecular Formula | C18H21ClFN6O8PS |
| Molecular Weight | 566.89 g/mol |
| Exact Mass | 566.06 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[5-chloro-7-[[(1S)-1-(4-fluorophenyl)ethyl]amino]triazolo[4,5-d]pyrimidin-3-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | C[C@H](Nc1nc(Cl)nc2c1nnn2[C@@H]1O[C@H](CS(=O)(=O)CP(=O)(O)O)[C@@H](O)[C@H]1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21ClFN6O8PS/c1-8(9-2-4-10(20)5-3-9)21-15-12-16(23-18(19)22-15)26(25-24-12)17-14(28)13(27)11(34-17)6-36(32,33)7-35(29,30)31/h2-5,8,11,13-14,17,27-28H,6-7H2,1H3,(H,21,22,23)(H2,29,30,31)/t8-,11+,13+,14+,17+/m0/s1 |
| InChIKey | XISKDIJCXDPDCS-AIGITPBPSA-N |
| XLogP | 0.36 |
| TPSA | 209.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.89 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|