C20H12Cl2N6O3 — CID 155268228
2-[3,5-dichloro-4-[(3-prop-1-en-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 155268228) has the molecular formula C20H12Cl2N6O3 and a molecular weight of 455.26 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[(3-prop-1-en-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[(3-prop-1-en-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 155268228 |
| Molecular Formula | C20H12Cl2N6O3 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 2-[3,5-dichloro-4-[(3-prop-1-en-2-yl-1H-pyrrolo[3,2-b]pyridin-5-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | C=C(C)c1c[nH]c2ccc(Oc3c(Cl)cc(-n4nc(C#N)c(=O)[nH]c4=O)cc3Cl)nc12 |
| InChI | InChI=1S/C20H12Cl2N6O3/c1-9(2)11-8-24-14-3-4-16(25-17(11)14)31-18-12(21)5-10(6-13(18)22)28-20(30)26-19(29)15(7-23)27-28/h3-6,8,24H,1H2,2H3,(H,26,29,30) |
| InChIKey | LMTFSXCFQQTXJL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |