C28H18Cl2F3N5O5S — CID 155268254
2-[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 155268254) has the molecular formula C28H18Cl2F3N5O5S and a molecular weight of 664.45 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 155268254 |
| Molecular Formula | C28H18Cl2F3N5O5S |
| Molecular Weight | 664.45 g/mol |
| Exact Mass | 663.04 |
| IUPAC Name | 2-[3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(C)C(F)(F)F)c3cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H18Cl2F3N5O5S/c1-14-3-6-18(7-4-14)44(41,42)37-13-20(15(2)28(31,32)33)19-11-17(5-8-24(19)37)43-25-21(29)9-16(10-22(25)30)38-27(40)35-26(39)23(12-34)36-38/h3-11,13,15H,1-2H3,(H,35,39,40) |
| InChIKey | LQGDVVRSDKTOSL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |