About 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine
3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine (PubChem CID 155268324) has the molecular formula C10H10Cl2F2N2
and a molecular weight of 267.11 g/mol. Its IUPAC name is 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine.
Molecular Properties
| Compound Name | 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine |
| PubChem CID | 155268324 |
| Molecular Formula | C10H10Cl2F2N2 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine |
| SMILES | CC(c1cc(Cl)nnc1Cl)C1CC(F)(F)C1 |
| InChI | InChI=1S/C10H10Cl2F2N2/c1-5(6-3-10(13,14)4-6)7-2-8(11)15-16-9(7)12/h2,5-6H,3-4H2,1H3 |
| InChIKey | YHVORJSWRHUXIV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine?
The IUPAC name of 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine (CID 155268324) is 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine.
What is the SMILES notation for 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine?
The canonical SMILES for 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine is CC(c1cc(Cl)nnc1Cl)C1CC(F)(F)C1.
What is the InChIKey of 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine?
The InChIKey is YHVORJSWRHUXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2F2N2/c1-5(6-3-10(13,14)4-6)7-2-8(11)15-16-9(7)12/h2,5-6H,3-4H2,1H3.
What are the key properties of 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine?
3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine has a molecular weight of 267.11 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloro-4-[1-(3,3-difluorocyclobutyl)ethyl]pyridazine is sourced from PubChem (CID 155268324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).