C25H14Cl2IN5O5S — CID 155268331
2-[3,5-dichloro-4-[3-iodo-1-(4-methylphenyl)sulfonylindol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 155268331) has the molecular formula C25H14Cl2IN5O5S and a molecular weight of 694.29 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[3-iodo-1-(4-methylphenyl)sulfonylindol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[3-iodo-1-(4-methylphenyl)sulfonylindol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 155268331 |
| Molecular Formula | C25H14Cl2IN5O5S |
| Molecular Weight | 694.29 g/mol |
| Exact Mass | 692.91 |
| IUPAC Name | 2-[3,5-dichloro-4-[3-iodo-1-(4-methylphenyl)sulfonylindol-5-yl]oxyphenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(I)c3cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H14Cl2IN5O5S/c1-13-2-5-16(6-3-13)39(36,37)32-12-20(28)17-10-15(4-7-22(17)32)38-23-18(26)8-14(9-19(23)27)33-25(35)30-24(34)21(11-29)31-33/h2-10,12H,1H3,(H,30,34,35) |
| InChIKey | SJJKIWOTCNCROY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|