C28H20Cl2N6O6S — CID 155268480
5-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N,N-dimethyl-1-(4-methylphenyl)sulfonylindole-3-carboxamide (PubChem CID 155268480) has the molecular formula C28H20Cl2N6O6S and a molecular weight of 639.48 g/mol. Its IUPAC name is 5-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N,N-dimethyl-1-(4-methylphenyl)sulfonylindole-3-carboxamide.
| Compound Name | 5-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N,N-dimethyl-1-(4-methylphenyl)sulfonylindole-3-carboxamide |
|---|---|
| PubChem CID | 155268480 |
| Molecular Formula | C28H20Cl2N6O6S |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 638.05 |
| IUPAC Name | 5-[2,6-dichloro-4-(6-cyano-3,5-dioxo-1,2,4-triazin-2-yl)phenoxy]-N,N-dimethyl-1-(4-methylphenyl)sulfonylindole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(=O)N(C)C)c3cc(Oc4c(Cl)cc(-n5nc(C#N)c(=O)[nH]c5=O)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C28H20Cl2N6O6S/c1-15-4-7-18(8-5-15)43(40,41)35-14-20(27(38)34(2)3)19-12-17(6-9-24(19)35)42-25-21(29)10-16(11-22(25)30)36-28(39)32-26(37)23(13-31)33-36/h4-12,14H,1-3H3,(H,32,37,39) |
| InChIKey | AXQSODUOOLQVOZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 160.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |